About N',N'-dicyclopentylethane-1,2-diamine
N',N'-dicyclopentylethane-1,2-diamine (PubChem CID 20816831) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is N',N'-dicyclopentylethane-1,2-diamine.
Molecular Properties
| Compound Name | N',N'-dicyclopentylethane-1,2-diamine |
| PubChem CID | 20816831 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N',N'-dicyclopentylethane-1,2-diamine |
| SMILES | NCCN(C1CCCC1)C1CCCC1 |
| InChI | InChI=1S/C12H24N2/c13-9-10-14(11-5-1-2-6-11)12-7-3-4-8-12/h11-12H,1-10,13H2 |
| InChIKey | LGPGLHGFBQRAPY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N',N'-dicyclopentylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-dicyclopentylethane-1,2-diamine?
The IUPAC name of N',N'-dicyclopentylethane-1,2-diamine (CID 20816831) is N',N'-dicyclopentylethane-1,2-diamine.
What is the SMILES notation for N',N'-dicyclopentylethane-1,2-diamine?
The canonical SMILES for N',N'-dicyclopentylethane-1,2-diamine is NCCN(C1CCCC1)C1CCCC1.
What is the InChIKey of N',N'-dicyclopentylethane-1,2-diamine?
The InChIKey is LGPGLHGFBQRAPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c13-9-10-14(11-5-1-2-6-11)12-7-3-4-8-12/h11-12H,1-10,13H2.
What are the key properties of N',N'-dicyclopentylethane-1,2-diamine?
N',N'-dicyclopentylethane-1,2-diamine has a molecular weight of 196.34 g/mol, XLogP of 2.13, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-dicyclopentylethane-1,2-diamine is sourced from PubChem (CID 20816831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).