About 8-hydroxy-1,6-naphthyridine-7-carboxylic acid
8-hydroxy-1,6-naphthyridine-7-carboxylic acid (PubChem CID 20816864) has the molecular formula C9H6N2O3
and a molecular weight of 190.16 g/mol. Its IUPAC name is 8-hydroxy-1,6-naphthyridine-7-carboxylic acid.
Molecular Properties
| Compound Name | 8-hydroxy-1,6-naphthyridine-7-carboxylic acid |
| PubChem CID | 20816864 |
| Molecular Formula | C9H6N2O3 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | 8-hydroxy-1,6-naphthyridine-7-carboxylic acid |
| SMILES | O=C(O)c1ncc2cccnc2c1O |
| InChI | InChI=1S/C9H6N2O3/c12-8-6-5(2-1-3-10-6)4-11-7(8)9(13)14/h1-4,12H,(H,13,14) |
| InChIKey | YKJPPGSOGMPOFH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-hydroxy-1,6-naphthyridine-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-1,6-naphthyridine-7-carboxylic acid?
The IUPAC name of 8-hydroxy-1,6-naphthyridine-7-carboxylic acid (CID 20816864) is 8-hydroxy-1,6-naphthyridine-7-carboxylic acid.
What is the SMILES notation for 8-hydroxy-1,6-naphthyridine-7-carboxylic acid?
The canonical SMILES for 8-hydroxy-1,6-naphthyridine-7-carboxylic acid is O=C(O)c1ncc2cccnc2c1O.
What is the InChIKey of 8-hydroxy-1,6-naphthyridine-7-carboxylic acid?
The InChIKey is YKJPPGSOGMPOFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3/c12-8-6-5(2-1-3-10-6)4-11-7(8)9(13)14/h1-4,12H,(H,13,14).
What are the key properties of 8-hydroxy-1,6-naphthyridine-7-carboxylic acid?
8-hydroxy-1,6-naphthyridine-7-carboxylic acid has a molecular weight of 190.16 g/mol, XLogP of 1.03, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-1,6-naphthyridine-7-carboxylic acid is sourced from PubChem (CID 20816864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).