8-hydroxy-1,6-naphthyridine-7-carboxylic acid

C9H6N2O3 — CID 20816864

IUPAC8-hydroxy-1,6-naphthyridine-7-carboxylic acid
SMILESO=C(O)c1ncc2cccnc2c1O
InChIInChI=1S/C9H6N2O3/c12-8-6-5(2-1-3-10-6)4-11-7(8)9(13)14/h1-4,12H,(H,13,14)
InChIKeyYKJPPGSOGMPOFH-UHFFFAOYSA-N
MW190.16 g/mol
LogP1.03
Rot. Bonds1

About 8-hydroxy-1,6-naphthyridine-7-carboxylic acid

8-hydroxy-1,6-naphthyridine-7-carboxylic acid (PubChem CID 20816864) has the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. Its IUPAC name is 8-hydroxy-1,6-naphthyridine-7-carboxylic acid.

Molecular Properties

Compound Name8-hydroxy-1,6-naphthyridine-7-carboxylic acid
PubChem CID20816864
Molecular FormulaC9H6N2O3
Molecular Weight190.16 g/mol
Exact Mass190.04
IUPAC Name8-hydroxy-1,6-naphthyridine-7-carboxylic acid
SMILESO=C(O)c1ncc2cccnc2c1O
InChIInChI=1S/C9H6N2O3/c12-8-6-5(2-1-3-10-6)4-11-7(8)9(13)14/h1-4,12H,(H,13,14)
InChIKeyYKJPPGSOGMPOFH-UHFFFAOYSA-N
XLogP1.03
TPSA83.31 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.16
LogP ≤ 51.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 8-hydroxy-1,6-naphthyridine-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-hydroxy-1,6-naphthyridine-7-carboxylic acid?
The IUPAC name of 8-hydroxy-1,6-naphthyridine-7-carboxylic acid (CID 20816864) is 8-hydroxy-1,6-naphthyridine-7-carboxylic acid.
What is the SMILES notation for 8-hydroxy-1,6-naphthyridine-7-carboxylic acid?
The canonical SMILES for 8-hydroxy-1,6-naphthyridine-7-carboxylic acid is O=C(O)c1ncc2cccnc2c1O.
What is the InChIKey of 8-hydroxy-1,6-naphthyridine-7-carboxylic acid?
The InChIKey is YKJPPGSOGMPOFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3/c12-8-6-5(2-1-3-10-6)4-11-7(8)9(13)14/h1-4,12H,(H,13,14).
What are the key properties of 8-hydroxy-1,6-naphthyridine-7-carboxylic acid?
8-hydroxy-1,6-naphthyridine-7-carboxylic acid has a molecular weight of 190.16 g/mol, XLogP of 1.03, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-1,6-naphthyridine-7-carboxylic acid is sourced from PubChem (CID 20816864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).