C31H34N10O2S — CID 20817087
N-[4-[4-amino-1-[4-(4-methylpiperazin-1-yl)cyclohexyl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-4-(2-nitrophenyl)-1,3-thiazol-2-amine (PubChem CID 20817087) has the molecular formula C31H34N10O2S and a molecular weight of 610.75 g/mol. Its IUPAC name is N-[4-[4-amino-1-[4-(4-methylpiperazin-1-yl)cyclohexyl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-4-(2-nitrophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[4-[4-amino-1-[4-(4-methylpiperazin-1-yl)cyclohexyl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-4-(2-nitrophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 20817087 |
| Molecular Formula | C31H34N10O2S |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | N-[4-[4-amino-1-[4-(4-methylpiperazin-1-yl)cyclohexyl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-4-(2-nitrophenyl)-1,3-thiazol-2-amine |
| SMILES | CN1CCN(C2CCC(n3nc(-c4ccc(Nc5nc(-c6ccccc6[N+](=O)[O-])cs5)cc4)c4c(N)ncnc43)CC2)CC1 |
| InChI | InChI=1S/C31H34N10O2S/c1-38-14-16-39(17-15-38)22-10-12-23(13-11-22)40-30-27(29(32)33-19-34-30)28(37-40)20-6-8-21(9-7-20)35-31-36-25(18-44-31)24-4-2-3-5-26(24)41(42)43/h2-9,18-19,22-23H,10-17H2,1H3,(H,35,36)(H2,32,33,34) |
| InChIKey | JYZONXHVIZKJLJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|