C25H22BrN3O3 — CID 2081711
N-benzhydryl-2-[(4R)-4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 2081711) has the molecular formula C25H22BrN3O3 and a molecular weight of 492.37 g/mol. Its IUPAC name is N-benzhydryl-2-[(4R)-4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-benzhydryl-2-[(4R)-4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 2081711 |
| Molecular Formula | C25H22BrN3O3 |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | N-benzhydryl-2-[(4R)-4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@]1(c2cccc(Br)c2)NC(=O)N(CC(=O)NC(c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C25H22BrN3O3/c1-25(19-13-8-14-20(26)15-19)23(31)29(24(32)28-25)16-21(30)27-22(17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-15,22H,16H2,1H3,(H,27,30)(H,28,32)/t25-/m1/s1 |
| InChIKey | ALOKJGJIYYQXCS-RUZDIDTESA-N |
| XLogP | 4.12 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|