C26H26N9O4+ — CID 20817387
N-[4-(4-amino-1-piperidin-1-ium-4-ylpyrazolo[3,4-d]pyrimidin-3-yl)-2-methoxyphenyl]-7-nitro-1H-indole-2-carboxamide (PubChem CID 20817387) has the molecular formula C26H26N9O4+ and a molecular weight of 528.55 g/mol. Its IUPAC name is N-[4-(4-amino-1-piperidin-1-ium-4-ylpyrazolo[3,4-d]pyrimidin-3-yl)-2-methoxyphenyl]-7-nitro-1H-indole-2-carboxamide.
| Compound Name | N-[4-(4-amino-1-piperidin-1-ium-4-ylpyrazolo[3,4-d]pyrimidin-3-yl)-2-methoxyphenyl]-7-nitro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 20817387 |
| Molecular Formula | C26H26N9O4+ |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | N-[4-(4-amino-1-piperidin-1-ium-4-ylpyrazolo[3,4-d]pyrimidin-3-yl)-2-methoxyphenyl]-7-nitro-1H-indole-2-carboxamide |
| SMILES | COc1cc(-c2nn(C3CC[NH2+]CC3)c3ncnc(N)c23)ccc1NC(=O)c1cc2cccc([N+](=O)[O-])c2[nH]1 |
| InChI | InChI=1S/C26H25N9O4/c1-39-20-12-15(23-21-24(27)29-13-30-25(21)34(33-23)16-7-9-28-10-8-16)5-6-17(20)32-26(36)18-11-14-3-2-4-19(35(37)38)22(14)31-18/h2-6,11-13,16,28,31H,7-10H2,1H3,(H,32,36)(H2,27,29,30)/p+1 |
| InChIKey | JEFSANJZNHXCNG-UHFFFAOYSA-O |
| XLogP | 2.62 |
| TPSA | 183.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|