C28H32FN9O4S — CID 20817422
N-[4-[4-amino-1-[4-(4-methylpiperazin-1-yl)cyclohexyl]pyrazolo[3,4-d]pyrimidin-3-yl]-2-fluorophenyl]-3-nitrobenzenesulfonamide (PubChem CID 20817422) has the molecular formula C28H32FN9O4S and a molecular weight of 609.69 g/mol. Its IUPAC name is N-[4-[4-amino-1-[4-(4-methylpiperazin-1-yl)cyclohexyl]pyrazolo[3,4-d]pyrimidin-3-yl]-2-fluorophenyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[4-[4-amino-1-[4-(4-methylpiperazin-1-yl)cyclohexyl]pyrazolo[3,4-d]pyrimidin-3-yl]-2-fluorophenyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 20817422 |
| Molecular Formula | C28H32FN9O4S |
| Molecular Weight | 609.69 g/mol |
| Exact Mass | 609.23 |
| IUPAC Name | N-[4-[4-amino-1-[4-(4-methylpiperazin-1-yl)cyclohexyl]pyrazolo[3,4-d]pyrimidin-3-yl]-2-fluorophenyl]-3-nitrobenzenesulfonamide |
| SMILES | CN1CCN(C2CCC(n3nc(-c4ccc(NS(=O)(=O)c5cccc([N+](=O)[O-])c5)c(F)c4)c4c(N)ncnc43)CC2)CC1 |
| InChI | InChI=1S/C28H32FN9O4S/c1-35-11-13-36(14-12-35)19-6-8-20(9-7-19)37-28-25(27(30)31-17-32-28)26(33-37)18-5-10-24(23(29)15-18)34-43(41,42)22-4-2-3-21(16-22)38(39)40/h2-5,10,15-17,19-20,34H,6-9,11-14H2,1H3,(H2,30,31,32) |
| InChIKey | NURADYKOUTVOCX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 165.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.69 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|