About (4Z)-2-hydroxy-N-methoxy-N-methyl-5-(trifluoromethyl)octa-4,7-dienamide
(4Z)-2-hydroxy-N-methoxy-N-methyl-5-(trifluoromethyl)octa-4,7-dienamide (PubChem CID 20817542) has the molecular formula C11H16F3NO3
and a molecular weight of 267.25 g/mol. Its IUPAC name is (4Z)-2-hydroxy-N-methoxy-N-methyl-5-(trifluoromethyl)octa-4,7-dienamide.
Molecular Properties
| Compound Name | (4Z)-2-hydroxy-N-methoxy-N-methyl-5-(trifluoromethyl)octa-4,7-dienamide |
| PubChem CID | 20817542 |
| Molecular Formula | C11H16F3NO3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (4Z)-2-hydroxy-N-methoxy-N-methyl-5-(trifluoromethyl)octa-4,7-dienamide |
| SMILES | C=CC/C(=C/CC(O)C(=O)N(C)OC)C(F)(F)F |
| InChI | InChI=1S/C11H16F3NO3/c1-4-5-8(11(12,13)14)6-7-9(16)10(17)15(2)18-3/h4,6,9,16H,1,5,7H2,2-3H3/b8-6- |
| InChIKey | PDXYRWVCPYFWMP-VURMDHGXSA-N |
| XLogP | 1.82 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-2-hydroxy-N-methoxy-N-methyl-5-(trifluoromethyl)octa-4,7-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-2-hydroxy-N-methoxy-N-methyl-5-(trifluoromethyl)octa-4,7-dienamide?
The IUPAC name of (4Z)-2-hydroxy-N-methoxy-N-methyl-5-(trifluoromethyl)octa-4,7-dienamide (CID 20817542) is (4Z)-2-hydroxy-N-methoxy-N-methyl-5-(trifluoromethyl)octa-4,7-dienamide.
What is the SMILES notation for (4Z)-2-hydroxy-N-methoxy-N-methyl-5-(trifluoromethyl)octa-4,7-dienamide?
The canonical SMILES for (4Z)-2-hydroxy-N-methoxy-N-methyl-5-(trifluoromethyl)octa-4,7-dienamide is C=CC/C(=C/CC(O)C(=O)N(C)OC)C(F)(F)F.
What is the InChIKey of (4Z)-2-hydroxy-N-methoxy-N-methyl-5-(trifluoromethyl)octa-4,7-dienamide?
The InChIKey is PDXYRWVCPYFWMP-VURMDHGXSA-N. The full InChI is InChI=1S/C11H16F3NO3/c1-4-5-8(11(12,13)14)6-7-9(16)10(17)15(2)18-3/h4,6,9,16H,1,5,7H2,2-3H3/b8-6-.
What are the key properties of (4Z)-2-hydroxy-N-methoxy-N-methyl-5-(trifluoromethyl)octa-4,7-dienamide?
(4Z)-2-hydroxy-N-methoxy-N-methyl-5-(trifluoromethyl)octa-4,7-dienamide has a molecular weight of 267.25 g/mol, XLogP of 1.82, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-2-hydroxy-N-methoxy-N-methyl-5-(trifluoromethyl)octa-4,7-dienamide is sourced from PubChem (CID 20817542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).