About N,N'-bis[1-(4-aminophenyl)pyrrolidin-3-yl]butane-1,4-diamine
N,N'-bis[1-(4-aminophenyl)pyrrolidin-3-yl]butane-1,4-diamine (PubChem CID 20817991) has the molecular formula C24H36N6
and a molecular weight of 408.59 g/mol. Its IUPAC name is N,N'-bis[1-(4-aminophenyl)pyrrolidin-3-yl]butane-1,4-diamine.
Molecular Properties
| Compound Name | N,N'-bis[1-(4-aminophenyl)pyrrolidin-3-yl]butane-1,4-diamine |
| PubChem CID | 20817991 |
| Molecular Formula | C24H36N6 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | N,N'-bis[1-(4-aminophenyl)pyrrolidin-3-yl]butane-1,4-diamine |
| SMILES | Nc1ccc(N2CCC(NCCCCNC3CCN(c4ccc(N)cc4)C3)C2)cc1 |
| InChI | InChI=1S/C24H36N6/c25-19-3-7-23(8-4-19)29-15-11-21(17-29)27-13-1-2-14-28-22-12-16-30(18-22)24-9-5-20(26)6-10-24/h3-10,21-22,27-28H,1-2,11-18,25-26H2 |
| InChIKey | CCGARGNRKPRSBY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 82.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis[1-(4-aminophenyl)pyrrolidin-3-yl]butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis[1-(4-aminophenyl)pyrrolidin-3-yl]butane-1,4-diamine?
The IUPAC name of N,N'-bis[1-(4-aminophenyl)pyrrolidin-3-yl]butane-1,4-diamine (CID 20817991) is N,N'-bis[1-(4-aminophenyl)pyrrolidin-3-yl]butane-1,4-diamine.
What is the SMILES notation for N,N'-bis[1-(4-aminophenyl)pyrrolidin-3-yl]butane-1,4-diamine?
The canonical SMILES for N,N'-bis[1-(4-aminophenyl)pyrrolidin-3-yl]butane-1,4-diamine is Nc1ccc(N2CCC(NCCCCNC3CCN(c4ccc(N)cc4)C3)C2)cc1.
What is the InChIKey of N,N'-bis[1-(4-aminophenyl)pyrrolidin-3-yl]butane-1,4-diamine?
The InChIKey is CCGARGNRKPRSBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H36N6/c25-19-3-7-23(8-4-19)29-15-11-21(17-29)27-13-1-2-14-28-22-12-16-30(18-22)24-9-5-20(26)6-10-24/h3-10,21-22,27-28H,1-2,11-18,25-26H2.
What are the key properties of N,N'-bis[1-(4-aminophenyl)pyrrolidin-3-yl]butane-1,4-diamine?
N,N'-bis[1-(4-aminophenyl)pyrrolidin-3-yl]butane-1,4-diamine has a molecular weight of 408.59 g/mol, XLogP of 2.67, 9 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis[1-(4-aminophenyl)pyrrolidin-3-yl]butane-1,4-diamine is sourced from PubChem (CID 20817991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).