About 2-[[3,4-dimethyl-6-[2-(trioxidanylsulfanyl)anilino]-2-pyridinyl]amino]benzenesulfonic acid
2-[[3,4-dimethyl-6-[2-(trioxidanylsulfanyl)anilino]-2-pyridinyl]amino]benzenesulfonic acid (PubChem CID 20818016) has the molecular formula C19H19N3O6S2
and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-[[3,4-dimethyl-6-[2-(trioxidanylsulfanyl)anilino]-2-pyridinyl]amino]benzenesulfonic acid.
Molecular Properties
| Compound Name | 2-[[3,4-dimethyl-6-[2-(trioxidanylsulfanyl)anilino]-2-pyridinyl]amino]benzenesulfonic acid |
| PubChem CID | 20818016 |
| Molecular Formula | C19H19N3O6S2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 2-[[3,4-dimethyl-6-[2-(trioxidanylsulfanyl)anilino]-2-pyridinyl]amino]benzenesulfonic acid |
| SMILES | Cc1cc(Nc2ccccc2SOOO)nc(Nc2ccccc2S(=O)(=O)O)c1C |
| InChI | InChI=1S/C19H19N3O6S2/c1-12-11-18(20-14-7-3-5-9-16(14)29-28-27-23)22-19(13(12)2)21-15-8-4-6-10-17(15)30(24,25)26/h3-11,23H,1-2H3,(H2,20,21,22)(H,24,25,26) |
| InChIKey | WJNXVEOGHQBVGH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 130.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3,4-dimethyl-6-[2-(trioxidanylsulfanyl)anilino]-2-pyridinyl]amino]benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,4-dimethyl-6-[2-(trioxidanylsulfanyl)anilino]-2-pyridinyl]amino]benzenesulfonic acid?
The IUPAC name of 2-[[3,4-dimethyl-6-[2-(trioxidanylsulfanyl)anilino]-2-pyridinyl]amino]benzenesulfonic acid (CID 20818016) is 2-[[3,4-dimethyl-6-[2-(trioxidanylsulfanyl)anilino]-2-pyridinyl]amino]benzenesulfonic acid.
What is the SMILES notation for 2-[[3,4-dimethyl-6-[2-(trioxidanylsulfanyl)anilino]-2-pyridinyl]amino]benzenesulfonic acid?
The canonical SMILES for 2-[[3,4-dimethyl-6-[2-(trioxidanylsulfanyl)anilino]-2-pyridinyl]amino]benzenesulfonic acid is Cc1cc(Nc2ccccc2SOOO)nc(Nc2ccccc2S(=O)(=O)O)c1C.
What is the InChIKey of 2-[[3,4-dimethyl-6-[2-(trioxidanylsulfanyl)anilino]-2-pyridinyl]amino]benzenesulfonic acid?
The InChIKey is WJNXVEOGHQBVGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O6S2/c1-12-11-18(20-14-7-3-5-9-16(14)29-28-27-23)22-19(13(12)2)21-15-8-4-6-10-17(15)30(24,25)26/h3-11,23H,1-2H3,(H2,20,21,22)(H,24,25,26).
What are the key properties of 2-[[3,4-dimethyl-6-[2-(trioxidanylsulfanyl)anilino]-2-pyridinyl]amino]benzenesulfonic acid?
2-[[3,4-dimethyl-6-[2-(trioxidanylsulfanyl)anilino]-2-pyridinyl]amino]benzenesulfonic acid has a molecular weight of 449.51 g/mol, XLogP of 4.86, 8 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,4-dimethyl-6-[2-(trioxidanylsulfanyl)anilino]-2-pyridinyl]amino]benzenesulfonic acid is sourced from PubChem (CID 20818016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).