C9H15F3N2O3 — CID 20818124
2-[diethyl-[[(2,2,2-trifluoroacetyl)amino]methyl]azaniumyl]acetate (PubChem CID 20818124) has the molecular formula C9H15F3N2O3 and a molecular weight of 256.22 g/mol. Its IUPAC name is 2-[diethyl-[[(2,2,2-trifluoroacetyl)amino]methyl]azaniumyl]acetate.
| Compound Name | 2-[diethyl-[[(2,2,2-trifluoroacetyl)amino]methyl]azaniumyl]acetate |
|---|---|
| PubChem CID | 20818124 |
| Molecular Formula | C9H15F3N2O3 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-[diethyl-[[(2,2,2-trifluoroacetyl)amino]methyl]azaniumyl]acetate |
| SMILES | CC[N+](CC)(CNC(=O)C(F)(F)F)CC(=O)[O-] |
| InChI | InChI=1S/C9H15F3N2O3/c1-3-14(4-2,5-7(15)16)6-13-8(17)9(10,11)12/h3-6H2,1-2H3,(H-,13,15,16,17) |
| InChIKey | NWOCXTYRVAGIQD-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|