C10H20O3 — CID 20818181
9,10-dimethyl-1,4,7-trioxacycloundecane (PubChem CID 20818181) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is 9,10-dimethyl-1,4,7-trioxacycloundecane.
| Compound Name | 9,10-dimethyl-1,4,7-trioxacycloundecane |
|---|---|
| PubChem CID | 20818181 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 9,10-dimethyl-1,4,7-trioxacycloundecane |
| SMILES | CC1COCCOCCOCC1C |
| InChI | InChI=1S/C10H20O3/c1-9-7-12-5-3-11-4-6-13-8-10(9)2/h9-10H,3-8H2,1-2H3 |
| InChIKey | BBDSRHSBLOXIMU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |