About 9,10-dimethyl-1,4,7-trioxacycloundecane
9,10-dimethyl-1,4,7-trioxacycloundecane (PubChem CID 20818181) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is 9,10-dimethyl-1,4,7-trioxacycloundecane.
Molecular Properties
| Compound Name | 9,10-dimethyl-1,4,7-trioxacycloundecane |
| PubChem CID | 20818181 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 9,10-dimethyl-1,4,7-trioxacycloundecane |
| SMILES | CC1COCCOCCOCC1C |
| InChI | InChI=1S/C10H20O3/c1-9-7-12-5-3-11-4-6-13-8-10(9)2/h9-10H,3-8H2,1-2H3 |
| InChIKey | BBDSRHSBLOXIMU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9,10-dimethyl-1,4,7-trioxacycloundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-dimethyl-1,4,7-trioxacycloundecane?
The IUPAC name of 9,10-dimethyl-1,4,7-trioxacycloundecane (CID 20818181) is 9,10-dimethyl-1,4,7-trioxacycloundecane.
What is the SMILES notation for 9,10-dimethyl-1,4,7-trioxacycloundecane?
The canonical SMILES for 9,10-dimethyl-1,4,7-trioxacycloundecane is CC1COCCOCCOCC1C.
What is the InChIKey of 9,10-dimethyl-1,4,7-trioxacycloundecane?
The InChIKey is BBDSRHSBLOXIMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-9-7-12-5-3-11-4-6-13-8-10(9)2/h9-10H,3-8H2,1-2H3.
What are the key properties of 9,10-dimethyl-1,4,7-trioxacycloundecane?
9,10-dimethyl-1,4,7-trioxacycloundecane has a molecular weight of 188.27 g/mol, XLogP of 1.32, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-dimethyl-1,4,7-trioxacycloundecane is sourced from PubChem (CID 20818181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).