C41H60O12 — CID 20818185
2-hydroxyethyl 5-(4-methyl-2,5-dioxooxolan-3-yl)-6-[2-methyl-2-(15-methyl-3,11-dioxo-4,10-dioxatricyclo[11.2.1.02,12]hexadecan-14-yl)-3-oxo-3-(2,3,3-trimethylbutan-2-yloxy)propyl]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 20818185) has the molecular formula C41H60O12 and a molecular weight of 744.92 g/mol. Its IUPAC name is 2-hydroxyethyl 5-(4-methyl-2,5-dioxooxolan-3-yl)-6-[2-methyl-2-(15-methyl-3,11-dioxo-4,10-dioxatricyclo[11.2.1.02,12]hexadecan-14-yl)-3-oxo-3-(2,3,3-trimethylbutan-2-yloxy)propyl]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 2-hydroxyethyl 5-(4-methyl-2,5-dioxooxolan-3-yl)-6-[2-methyl-2-(15-methyl-3,11-dioxo-4,10-dioxatricyclo[11.2.1.02,12]hexadecan-14-yl)-3-oxo-3-(2,3,3-trimethylbutan-2-yloxy)propyl]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 20818185 |
| Molecular Formula | C41H60O12 |
| Molecular Weight | 744.92 g/mol |
| Exact Mass | 744.41 |
| IUPAC Name | 2-hydroxyethyl 5-(4-methyl-2,5-dioxooxolan-3-yl)-6-[2-methyl-2-(15-methyl-3,11-dioxo-4,10-dioxatricyclo[11.2.1.02,12]hexadecan-14-yl)-3-oxo-3-(2,3,3-trimethylbutan-2-yloxy)propyl]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC1C(=O)OC(=O)C1C1C2CC(C(=O)OCCO)C(C2)C1CC(C)(C(=O)OC(C)(C)C(C)(C)C)C1C(C)C2CC1C1C(=O)OCCCCCOC(=O)C21 |
| InChI | InChI=1S/C41H60O12/c1-20-23-18-26(31-30(23)35(45)49-13-10-9-11-14-50-36(31)46)32(20)41(8,38(48)53-40(6,7)39(3,4)5)19-27-24-16-22(17-25(24)34(44)51-15-12-42)29(27)28-21(2)33(43)52-37(28)47/h20-32,42H,9-19H2,1-8H3 |
| InChIKey | VXVPLYIPQPOCLH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 168.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.92 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|