About 3-(5-chloro-2H-1,3-benzothiazol-3-yl)propane-1-sulfonate
3-(5-chloro-2H-1,3-benzothiazol-3-yl)propane-1-sulfonate (PubChem CID 20818380) has the molecular formula C10H11ClNO3S2-
and a molecular weight of 292.79 g/mol. Its IUPAC name is 3-(5-chloro-2H-1,3-benzothiazol-3-yl)propane-1-sulfonate.
Molecular Properties
| Compound Name | 3-(5-chloro-2H-1,3-benzothiazol-3-yl)propane-1-sulfonate |
| PubChem CID | 20818380 |
| Molecular Formula | C10H11ClNO3S2- |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 3-(5-chloro-2H-1,3-benzothiazol-3-yl)propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCN1CSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C10H12ClNO3S2/c11-8-2-3-10-9(6-8)12(7-16-10)4-1-5-17(13,14)15/h2-3,6H,1,4-5,7H2,(H,13,14,15)/p-1 |
| InChIKey | GSKAHANPZZRTBF-UHFFFAOYSA-M |
| XLogP | 2.14 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-chloro-2H-1,3-benzothiazol-3-yl)propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-chloro-2H-1,3-benzothiazol-3-yl)propane-1-sulfonate?
The IUPAC name of 3-(5-chloro-2H-1,3-benzothiazol-3-yl)propane-1-sulfonate (CID 20818380) is 3-(5-chloro-2H-1,3-benzothiazol-3-yl)propane-1-sulfonate.
What is the SMILES notation for 3-(5-chloro-2H-1,3-benzothiazol-3-yl)propane-1-sulfonate?
The canonical SMILES for 3-(5-chloro-2H-1,3-benzothiazol-3-yl)propane-1-sulfonate is O=S(=O)([O-])CCCN1CSc2ccc(Cl)cc21.
What is the InChIKey of 3-(5-chloro-2H-1,3-benzothiazol-3-yl)propane-1-sulfonate?
The InChIKey is GSKAHANPZZRTBF-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H12ClNO3S2/c11-8-2-3-10-9(6-8)12(7-16-10)4-1-5-17(13,14)15/h2-3,6H,1,4-5,7H2,(H,13,14,15)/p-1.
What are the key properties of 3-(5-chloro-2H-1,3-benzothiazol-3-yl)propane-1-sulfonate?
3-(5-chloro-2H-1,3-benzothiazol-3-yl)propane-1-sulfonate has a molecular weight of 292.79 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-chloro-2H-1,3-benzothiazol-3-yl)propane-1-sulfonate is sourced from PubChem (CID 20818380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).