C43H23N3O2 — CID 20818459
N-[2-(5-methyl-2-phenyl-1H-imidazol-4-yl)phenyl]-N-[(4-octadeca-1,3,5,7,9,11,13,15,17-nonaynoxyphenyl)methyl]acetamide (PubChem CID 20818459) has the molecular formula C43H23N3O2 and a molecular weight of 613.68 g/mol. Its IUPAC name is N-[2-(5-methyl-2-phenyl-1H-imidazol-4-yl)phenyl]-N-[(4-octadeca-1,3,5,7,9,11,13,15,17-nonaynoxyphenyl)methyl]acetamide.
| Compound Name | N-[2-(5-methyl-2-phenyl-1H-imidazol-4-yl)phenyl]-N-[(4-octadeca-1,3,5,7,9,11,13,15,17-nonaynoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 20818459 |
| Molecular Formula | C43H23N3O2 |
| Molecular Weight | 613.68 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | N-[2-(5-methyl-2-phenyl-1H-imidazol-4-yl)phenyl]-N-[(4-octadeca-1,3,5,7,9,11,13,15,17-nonaynoxyphenyl)methyl]acetamide |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#COc1ccc(CN(C(C)=O)c2ccccc2-c2nc(-c3ccccc3)[nH]c2C)cc1 |
| InChI | InChI=1S/C43H23N3O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-33-48-39-31-29-37(30-32-39)34-46(36(3)47)41-28-23-22-27-40(41)42-35(2)44-43(45-42)38-25-20-19-21-26-38/h1,19-23,25-32H,34H2,2-3H3,(H,44,45) |
| InChIKey | OOGIBODDLTUYQT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.68 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|