About methyl 2-[4-[3-[2,2-bis(4-chlorophenyl)ethyl-methylamino]propyl]phenoxy]-2-methoxyacetate
methyl 2-[4-[3-[2,2-bis(4-chlorophenyl)ethyl-methylamino]propyl]phenoxy]-2-methoxyacetate (PubChem CID 20820635) has the molecular formula C28H31Cl2NO4
and a molecular weight of 516.47 g/mol. Its IUPAC name is methyl 2-[4-[3-[2,2-bis(4-chlorophenyl)ethyl-methylamino]propyl]phenoxy]-2-methoxyacetate.
Molecular Properties
| Compound Name | methyl 2-[4-[3-[2,2-bis(4-chlorophenyl)ethyl-methylamino]propyl]phenoxy]-2-methoxyacetate |
| PubChem CID | 20820635 |
| Molecular Formula | C28H31Cl2NO4 |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | methyl 2-[4-[3-[2,2-bis(4-chlorophenyl)ethyl-methylamino]propyl]phenoxy]-2-methoxyacetate |
| SMILES | COC(=O)C(OC)Oc1ccc(CCCN(C)CC(c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H31Cl2NO4/c1-31(18-4-5-20-6-16-25(17-7-20)35-28(34-3)27(32)33-2)19-26(21-8-12-23(29)13-9-21)22-10-14-24(30)15-11-22/h6-17,26,28H,4-5,18-19H2,1-3H3 |
| InChIKey | WYJVACAGDKSHAG-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[4-[3-[2,2-bis(4-chlorophenyl)ethyl-methylamino]propyl]phenoxy]-2-methoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-[3-[2,2-bis(4-chlorophenyl)ethyl-methylamino]propyl]phenoxy]-2-methoxyacetate?
The IUPAC name of methyl 2-[4-[3-[2,2-bis(4-chlorophenyl)ethyl-methylamino]propyl]phenoxy]-2-methoxyacetate (CID 20820635) is methyl 2-[4-[3-[2,2-bis(4-chlorophenyl)ethyl-methylamino]propyl]phenoxy]-2-methoxyacetate.
What is the SMILES notation for methyl 2-[4-[3-[2,2-bis(4-chlorophenyl)ethyl-methylamino]propyl]phenoxy]-2-methoxyacetate?
The canonical SMILES for methyl 2-[4-[3-[2,2-bis(4-chlorophenyl)ethyl-methylamino]propyl]phenoxy]-2-methoxyacetate is COC(=O)C(OC)Oc1ccc(CCCN(C)CC(c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc1.
What is the InChIKey of methyl 2-[4-[3-[2,2-bis(4-chlorophenyl)ethyl-methylamino]propyl]phenoxy]-2-methoxyacetate?
The InChIKey is WYJVACAGDKSHAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H31Cl2NO4/c1-31(18-4-5-20-6-16-25(17-7-20)35-28(34-3)27(32)33-2)19-26(21-8-12-23(29)13-9-21)22-10-14-24(30)15-11-22/h6-17,26,28H,4-5,18-19H2,1-3H3.
What are the key properties of methyl 2-[4-[3-[2,2-bis(4-chlorophenyl)ethyl-methylamino]propyl]phenoxy]-2-methoxyacetate?
methyl 2-[4-[3-[2,2-bis(4-chlorophenyl)ethyl-methylamino]propyl]phenoxy]-2-methoxyacetate has a molecular weight of 516.47 g/mol, XLogP of 6.21, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-[3-[2,2-bis(4-chlorophenyl)ethyl-methylamino]propyl]phenoxy]-2-methoxyacetate is sourced from PubChem (CID 20820635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).