About 1-O-(2-methylbutan-2-yl) 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethyl-4-methylpentanedioate
1-O-(2-methylbutan-2-yl) 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethyl-4-methylpentanedioate (PubChem CID 20820773) has the molecular formula C23H40O4
and a molecular weight of 380.57 g/mol. Its IUPAC name is 1-O-(2-methylbutan-2-yl) 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethyl-4-methylpentanedioate.
Molecular Properties
| Compound Name | 1-O-(2-methylbutan-2-yl) 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethyl-4-methylpentanedioate |
| PubChem CID | 20820773 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 1-O-(2-methylbutan-2-yl) 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethyl-4-methylpentanedioate |
| SMILES | CCC(CC(C)C(=O)OC1CC2CCC1(C)C2(C)C)C(=O)OC(C)(C)CC |
| InChI | InChI=1S/C23H40O4/c1-9-16(20(25)27-21(4,5)10-2)13-15(3)19(24)26-18-14-17-11-12-23(18,8)22(17,6)7/h15-18H,9-14H2,1-8H3 |
| InChIKey | NIXJWZFMCZNNCA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-O-(2-methylbutan-2-yl) 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethyl-4-methylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(2-methylbutan-2-yl) 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethyl-4-methylpentanedioate?
The IUPAC name of 1-O-(2-methylbutan-2-yl) 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethyl-4-methylpentanedioate (CID 20820773) is 1-O-(2-methylbutan-2-yl) 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethyl-4-methylpentanedioate.
What is the SMILES notation for 1-O-(2-methylbutan-2-yl) 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethyl-4-methylpentanedioate?
The canonical SMILES for 1-O-(2-methylbutan-2-yl) 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethyl-4-methylpentanedioate is CCC(CC(C)C(=O)OC1CC2CCC1(C)C2(C)C)C(=O)OC(C)(C)CC.
What is the InChIKey of 1-O-(2-methylbutan-2-yl) 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethyl-4-methylpentanedioate?
The InChIKey is NIXJWZFMCZNNCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H40O4/c1-9-16(20(25)27-21(4,5)10-2)13-15(3)19(24)26-18-14-17-11-12-23(18,8)22(17,6)7/h15-18H,9-14H2,1-8H3.
What are the key properties of 1-O-(2-methylbutan-2-yl) 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethyl-4-methylpentanedioate?
1-O-(2-methylbutan-2-yl) 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethyl-4-methylpentanedioate has a molecular weight of 380.57 g/mol, XLogP of 5.53, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(2-methylbutan-2-yl) 5-O-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-ethyl-4-methylpentanedioate is sourced from PubChem (CID 20820773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).