C24H34O7 — CID 20820798
5-O-(1-ethoxyethyl) 4-O-(2-oxooxolan-3-yl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4,5-dicarboxylate (PubChem CID 20820798) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is 5-O-(1-ethoxyethyl) 4-O-(2-oxooxolan-3-yl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4,5-dicarboxylate.
| Compound Name | 5-O-(1-ethoxyethyl) 4-O-(2-oxooxolan-3-yl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 20820798 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 5-O-(1-ethoxyethyl) 4-O-(2-oxooxolan-3-yl) 9,10-dimethyltetracyclo[6.2.1.13,6.02,7]dodecane-4,5-dicarboxylate |
| SMILES | CCOC(C)OC(=O)C1C2CC(C1C(=O)OC1CCOC1=O)C1C3CC(C(C)C3C)C21 |
| InChI | InChI=1S/C24H34O7/c1-5-28-12(4)30-23(26)20-15-9-16(19-14-8-13(18(15)19)10(2)11(14)3)21(20)24(27)31-17-6-7-29-22(17)25/h10-21H,5-9H2,1-4H3 |
| InChIKey | PDAPOCPMCMTXBE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|