C8H12O4 — CID 20820810
(6Z)-3-methyl-2,3,5,8-tetrahydro-1,4-dioxocine-2-carboxylic acid (PubChem CID 20820810) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is (6Z)-3-methyl-2,3,5,8-tetrahydro-1,4-dioxocine-2-carboxylic acid.
| Compound Name | (6Z)-3-methyl-2,3,5,8-tetrahydro-1,4-dioxocine-2-carboxylic acid |
|---|---|
| PubChem CID | 20820810 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (6Z)-3-methyl-2,3,5,8-tetrahydro-1,4-dioxocine-2-carboxylic acid |
| SMILES | CC1OC/C=C\COC1C(=O)O |
| InChI | InChI=1S/C8H12O4/c1-6-7(8(9)10)12-5-3-2-4-11-6/h2-3,6-7H,4-5H2,1H3,(H,9,10)/b3-2- |
| InChIKey | KVZNUZZNOJQDNM-IHWYPQMZSA-N |
| XLogP | 0.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|