C31H41N5O4 — CID 20820840
methyl 2-[[2-(3,5-dimethylphenyl)-6-isocyano-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl]methyl-(2-methoxy-2-oxoethyl)amino]acetate (PubChem CID 20820840) has the molecular formula C31H41N5O4 and a molecular weight of 547.70 g/mol. Its IUPAC name is methyl 2-[[2-(3,5-dimethylphenyl)-6-isocyano-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl]methyl-(2-methoxy-2-oxoethyl)amino]acetate.
| Compound Name | methyl 2-[[2-(3,5-dimethylphenyl)-6-isocyano-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl]methyl-(2-methoxy-2-oxoethyl)amino]acetate |
|---|---|
| PubChem CID | 20820840 |
| Molecular Formula | C31H41N5O4 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.32 |
| IUPAC Name | methyl 2-[[2-(3,5-dimethylphenyl)-6-isocyano-7-[(2,4,6-trimethylcyclohexyl)methyl]-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl]methyl-(2-methoxy-2-oxoethyl)amino]acetate |
| SMILES | [C-]#[N+]c1c(CC2C(C)CC(C)CC2C)c2nc(-c3cc(C)cc(C)c3)[nH]n2c1CN(CC(=O)OC)CC(=O)OC |
| InChI | InChI=1S/C31H41N5O4/c1-18-9-19(2)13-23(12-18)30-33-31-25(14-24-21(4)10-20(3)11-22(24)5)29(32-6)26(36(31)34-30)15-35(16-27(37)39-7)17-28(38)40-8/h9,12-13,20-22,24H,10-11,14-17H2,1-5,7-8H3,(H,33,34) |
| InChIKey | PQRKGIYCDFXMQY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|