About N-benzyl-N,2-dimethylquinoline-3-carboxamide
N-benzyl-N,2-dimethylquinoline-3-carboxamide (PubChem CID 2082101) has the molecular formula C19H18N2O
and a molecular weight of 290.37 g/mol. Its IUPAC name is N-benzyl-N,2-dimethylquinoline-3-carboxamide.
Molecular Properties
| Compound Name | N-benzyl-N,2-dimethylquinoline-3-carboxamide |
| PubChem CID | 2082101 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-benzyl-N,2-dimethylquinoline-3-carboxamide |
| SMILES | Cc1nc2ccccc2cc1C(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C19H18N2O/c1-14-17(12-16-10-6-7-11-18(16)20-14)19(22)21(2)13-15-8-4-3-5-9-15/h3-12H,13H2,1-2H3 |
| InChIKey | ZHIRTBXUANGNSQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzyl-N,2-dimethylquinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N,2-dimethylquinoline-3-carboxamide?
The IUPAC name of N-benzyl-N,2-dimethylquinoline-3-carboxamide (CID 2082101) is N-benzyl-N,2-dimethylquinoline-3-carboxamide.
What is the SMILES notation for N-benzyl-N,2-dimethylquinoline-3-carboxamide?
The canonical SMILES for N-benzyl-N,2-dimethylquinoline-3-carboxamide is Cc1nc2ccccc2cc1C(=O)N(C)Cc1ccccc1.
What is the InChIKey of N-benzyl-N,2-dimethylquinoline-3-carboxamide?
The InChIKey is ZHIRTBXUANGNSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O/c1-14-17(12-16-10-6-7-11-18(16)20-14)19(22)21(2)13-15-8-4-3-5-9-15/h3-12H,13H2,1-2H3.
What are the key properties of N-benzyl-N,2-dimethylquinoline-3-carboxamide?
N-benzyl-N,2-dimethylquinoline-3-carboxamide has a molecular weight of 290.37 g/mol, XLogP of 3.82, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N,2-dimethylquinoline-3-carboxamide is sourced from PubChem (CID 2082101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).