About N-[2-[(6,7-dichloro-3-methylsulfonylquinoxalin-2-yl)amino]ethyl]acetamide
N-[2-[(6,7-dichloro-3-methylsulfonylquinoxalin-2-yl)amino]ethyl]acetamide (PubChem CID 20821273) has the molecular formula C13H14Cl2N4O3S
and a molecular weight of 377.25 g/mol. Its IUPAC name is N-[2-[(6,7-dichloro-3-methylsulfonylquinoxalin-2-yl)amino]ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-[(6,7-dichloro-3-methylsulfonylquinoxalin-2-yl)amino]ethyl]acetamide |
| PubChem CID | 20821273 |
| Molecular Formula | C13H14Cl2N4O3S |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | N-[2-[(6,7-dichloro-3-methylsulfonylquinoxalin-2-yl)amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1nc2cc(Cl)c(Cl)cc2nc1S(C)(=O)=O |
| InChI | InChI=1S/C13H14Cl2N4O3S/c1-7(20)16-3-4-17-12-13(23(2,21)22)19-11-6-9(15)8(14)5-10(11)18-12/h5-6H,3-4H2,1-2H3,(H,16,20)(H,17,18) |
| InChIKey | JGBFNPODJNUABF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(6,7-dichloro-3-methylsulfonylquinoxalin-2-yl)amino]ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(6,7-dichloro-3-methylsulfonylquinoxalin-2-yl)amino]ethyl]acetamide?
The IUPAC name of N-[2-[(6,7-dichloro-3-methylsulfonylquinoxalin-2-yl)amino]ethyl]acetamide (CID 20821273) is N-[2-[(6,7-dichloro-3-methylsulfonylquinoxalin-2-yl)amino]ethyl]acetamide.
What is the SMILES notation for N-[2-[(6,7-dichloro-3-methylsulfonylquinoxalin-2-yl)amino]ethyl]acetamide?
The canonical SMILES for N-[2-[(6,7-dichloro-3-methylsulfonylquinoxalin-2-yl)amino]ethyl]acetamide is CC(=O)NCCNc1nc2cc(Cl)c(Cl)cc2nc1S(C)(=O)=O.
What is the InChIKey of N-[2-[(6,7-dichloro-3-methylsulfonylquinoxalin-2-yl)amino]ethyl]acetamide?
The InChIKey is JGBFNPODJNUABF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2N4O3S/c1-7(20)16-3-4-17-12-13(23(2,21)22)19-11-6-9(15)8(14)5-10(11)18-12/h5-6H,3-4H2,1-2H3,(H,16,20)(H,17,18).
What are the key properties of N-[2-[(6,7-dichloro-3-methylsulfonylquinoxalin-2-yl)amino]ethyl]acetamide?
N-[2-[(6,7-dichloro-3-methylsulfonylquinoxalin-2-yl)amino]ethyl]acetamide has a molecular weight of 377.25 g/mol, XLogP of 1.89, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(6,7-dichloro-3-methylsulfonylquinoxalin-2-yl)amino]ethyl]acetamide is sourced from PubChem (CID 20821273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).