About 2-ethyl-2,6-dimethyloxan-4-amine
2-ethyl-2,6-dimethyloxan-4-amine (PubChem CID 20821375) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is 2-ethyl-2,6-dimethyloxan-4-amine.
Molecular Properties
| Compound Name | 2-ethyl-2,6-dimethyloxan-4-amine |
| PubChem CID | 20821375 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 2-ethyl-2,6-dimethyloxan-4-amine |
| SMILES | CCC1(C)CC(N)CC(C)O1 |
| InChI | InChI=1S/C9H19NO/c1-4-9(3)6-8(10)5-7(2)11-9/h7-8H,4-6,10H2,1-3H3 |
| InChIKey | WGRMCVKGVCSHAC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-2,6-dimethyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2,6-dimethyloxan-4-amine?
The IUPAC name of 2-ethyl-2,6-dimethyloxan-4-amine (CID 20821375) is 2-ethyl-2,6-dimethyloxan-4-amine.
What is the SMILES notation for 2-ethyl-2,6-dimethyloxan-4-amine?
The canonical SMILES for 2-ethyl-2,6-dimethyloxan-4-amine is CCC1(C)CC(N)CC(C)O1.
What is the InChIKey of 2-ethyl-2,6-dimethyloxan-4-amine?
The InChIKey is WGRMCVKGVCSHAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO/c1-4-9(3)6-8(10)5-7(2)11-9/h7-8H,4-6,10H2,1-3H3.
What are the key properties of 2-ethyl-2,6-dimethyloxan-4-amine?
2-ethyl-2,6-dimethyloxan-4-amine has a molecular weight of 157.26 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,6-dimethyloxan-4-amine is sourced from PubChem (CID 20821375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).