C26H28N2O9 — CID 20821416
[8-benzyl-3-[(3-hydroxy-4-methylpyridine-2-carbonyl)amino]-6-methyl-2,4,9-trioxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 20821416) has the molecular formula C26H28N2O9 and a molecular weight of 512.52 g/mol. Its IUPAC name is [8-benzyl-3-[(3-hydroxy-4-methylpyridine-2-carbonyl)amino]-6-methyl-2,4,9-trioxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [8-benzyl-3-[(3-hydroxy-4-methylpyridine-2-carbonyl)amino]-6-methyl-2,4,9-trioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 20821416 |
| Molecular Formula | C26H28N2O9 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | [8-benzyl-3-[(3-hydroxy-4-methylpyridine-2-carbonyl)amino]-6-methyl-2,4,9-trioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | Cc1ccnc(C(=O)NC2C(=O)OC(=O)C(Cc3ccccc3)C(OC(=O)C(C)C)C(C)OC2=O)c1O |
| InChI | InChI=1S/C26H28N2O9/c1-13(2)23(31)36-21-15(4)35-25(33)19(28-22(30)18-20(29)14(3)10-11-27-18)26(34)37-24(32)17(21)12-16-8-6-5-7-9-16/h5-11,13,15,17,19,21,29H,12H2,1-4H3,(H,28,30) |
| InChIKey | XMGRXMJOOPATBH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|