C31H25NOS — CID 20821436
1-[3-[2-(4,5-diphenylthiophen-2-yl)phenyl]anilino]propan-2-one (PubChem CID 20821436) has the molecular formula C31H25NOS and a molecular weight of 459.61 g/mol. Its IUPAC name is 1-[3-[2-(4,5-diphenylthiophen-2-yl)phenyl]anilino]propan-2-one.
| Compound Name | 1-[3-[2-(4,5-diphenylthiophen-2-yl)phenyl]anilino]propan-2-one |
|---|---|
| PubChem CID | 20821436 |
| Molecular Formula | C31H25NOS |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 1-[3-[2-(4,5-diphenylthiophen-2-yl)phenyl]anilino]propan-2-one |
| SMILES | CC(=O)CNc1cccc(-c2ccccc2-c2cc(-c3ccccc3)c(-c3ccccc3)s2)c1 |
| InChI | InChI=1S/C31H25NOS/c1-22(33)21-32-26-16-10-15-25(19-26)27-17-8-9-18-28(27)30-20-29(23-11-4-2-5-12-23)31(34-30)24-13-6-3-7-14-24/h2-20,32H,21H2,1H3 |
| InChIKey | QMMDXBSALAHAFK-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |