C13H26O2 — CID 20821698
4-methoxy-2,2,3,5,6,6-hexamethylcyclohexan-1-ol (PubChem CID 20821698) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is 4-methoxy-2,2,3,5,6,6-hexamethylcyclohexan-1-ol.
| Compound Name | 4-methoxy-2,2,3,5,6,6-hexamethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 20821698 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 4-methoxy-2,2,3,5,6,6-hexamethylcyclohexan-1-ol |
| SMILES | COC1C(C)C(C)(C)C(O)C(C)(C)C1C |
| InChI | InChI=1S/C13H26O2/c1-8-10(15-7)9(2)13(5,6)11(14)12(8,3)4/h8-11,14H,1-7H3 |
| InChIKey | YYOXFZDUWAGOQB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |