About 4-(1,4-dihydroxybutan-2-ylamino)-2-(methanesulfonamido)-4-oxobutanoic acid
4-(1,4-dihydroxybutan-2-ylamino)-2-(methanesulfonamido)-4-oxobutanoic acid (PubChem CID 20821759) has the molecular formula C9H18N2O7S
and a molecular weight of 298.32 g/mol. Its IUPAC name is 4-(1,4-dihydroxybutan-2-ylamino)-2-(methanesulfonamido)-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-(1,4-dihydroxybutan-2-ylamino)-2-(methanesulfonamido)-4-oxobutanoic acid |
| PubChem CID | 20821759 |
| Molecular Formula | C9H18N2O7S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 4-(1,4-dihydroxybutan-2-ylamino)-2-(methanesulfonamido)-4-oxobutanoic acid |
| SMILES | CS(=O)(=O)NC(CC(=O)NC(CO)CCO)C(=O)O |
| InChI | InChI=1S/C9H18N2O7S/c1-19(17,18)11-7(9(15)16)4-8(14)10-6(5-13)2-3-12/h6-7,11-13H,2-5H2,1H3,(H,10,14)(H,15,16) |
| InChIKey | CYHZMWSLWPSRIW-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(1,4-dihydroxybutan-2-ylamino)-2-(methanesulfonamido)-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,4-dihydroxybutan-2-ylamino)-2-(methanesulfonamido)-4-oxobutanoic acid?
The IUPAC name of 4-(1,4-dihydroxybutan-2-ylamino)-2-(methanesulfonamido)-4-oxobutanoic acid (CID 20821759) is 4-(1,4-dihydroxybutan-2-ylamino)-2-(methanesulfonamido)-4-oxobutanoic acid.
What is the SMILES notation for 4-(1,4-dihydroxybutan-2-ylamino)-2-(methanesulfonamido)-4-oxobutanoic acid?
The canonical SMILES for 4-(1,4-dihydroxybutan-2-ylamino)-2-(methanesulfonamido)-4-oxobutanoic acid is CS(=O)(=O)NC(CC(=O)NC(CO)CCO)C(=O)O.
What is the InChIKey of 4-(1,4-dihydroxybutan-2-ylamino)-2-(methanesulfonamido)-4-oxobutanoic acid?
The InChIKey is CYHZMWSLWPSRIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O7S/c1-19(17,18)11-7(9(15)16)4-8(14)10-6(5-13)2-3-12/h6-7,11-13H,2-5H2,1H3,(H,10,14)(H,15,16).
What are the key properties of 4-(1,4-dihydroxybutan-2-ylamino)-2-(methanesulfonamido)-4-oxobutanoic acid?
4-(1,4-dihydroxybutan-2-ylamino)-2-(methanesulfonamido)-4-oxobutanoic acid has a molecular weight of 298.32 g/mol, XLogP of -2.76, 9 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4-dihydroxybutan-2-ylamino)-2-(methanesulfonamido)-4-oxobutanoic acid is sourced from PubChem (CID 20821759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).