C57H44O — CID 20822210
9-[7-(7-methoxy-9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-10-(4-phenylphenyl)anthracene (PubChem CID 20822210) has the molecular formula C57H44O and a molecular weight of 744.98 g/mol. Its IUPAC name is 9-[7-(7-methoxy-9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-10-(4-phenylphenyl)anthracene.
| Compound Name | 9-[7-(7-methoxy-9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-10-(4-phenylphenyl)anthracene |
|---|---|
| PubChem CID | 20822210 |
| Molecular Formula | C57H44O |
| Molecular Weight | 744.98 g/mol |
| Exact Mass | 744.34 |
| IUPAC Name | 9-[7-(7-methoxy-9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-10-(4-phenylphenyl)anthracene |
| SMILES | COc1ccc2c(c1)C(C)(C)c1cc(-c3ccc4c(c3)C(C)(C)c3cc(-c5c6ccccc6c(-c6ccc(-c7ccccc7)cc6)c6ccccc56)ccc3-4)ccc1-2 |
| InChI | InChI=1S/C57H44O/c1-56(2)50-31-38(39-24-28-43-45-30-26-41(58-5)34-53(45)57(3,4)51(43)32-39)23-27-42(50)44-29-25-40(33-52(44)56)55-48-17-11-9-15-46(48)54(47-16-10-12-18-49(47)55)37-21-19-36(20-22-37)35-13-7-6-8-14-35/h6-34H,1-5H3 |
| InChIKey | NANARFOEODTYCO-UHFFFAOYSA-N |
| XLogP | 15.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.98 |
| LogP ≤ 5 | 15.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|