C75H58O2 — CID 20822251
9-(9,9-dimethylfluoren-2-yl)-10-[10-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-4-methoxyanthracen-9-yl]-1-methoxyanthracene (PubChem CID 20822251) has the molecular formula C75H58O2 and a molecular weight of 991.29 g/mol. Its IUPAC name is 9-(9,9-dimethylfluoren-2-yl)-10-[10-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-4-methoxyanthracen-9-yl]-1-methoxyanthracene.
| Compound Name | 9-(9,9-dimethylfluoren-2-yl)-10-[10-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-4-methoxyanthracen-9-yl]-1-methoxyanthracene |
|---|---|
| PubChem CID | 20822251 |
| Molecular Formula | C75H58O2 |
| Molecular Weight | 991.29 g/mol |
| Exact Mass | 990.44 |
| IUPAC Name | 9-(9,9-dimethylfluoren-2-yl)-10-[10-[7-(9,9-dimethylfluoren-2-yl)-9,9-dimethylfluoren-2-yl]-4-methoxyanthracen-9-yl]-1-methoxyanthracene |
| SMILES | COc1cccc2c(-c3c4ccccc4c(-c4ccc5c(c4)C(C)(C)c4cc(-c6ccc7c(c6)C(C)(C)c6ccccc6-7)ccc4-5)c4c(OC)cccc34)c3ccccc3c(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c12 |
| InChI | InChI=1S/C75H58O2/c1-73(2)59-27-15-13-19-47(59)49-35-31-43(39-61(49)73)44-32-36-51-52-38-34-46(42-64(52)75(5,6)62(51)40-44)68-54-22-10-12-24-56(54)70(58-26-18-30-66(77-8)72(58)68)69-55-23-11-9-21-53(55)67(71-57(69)25-17-29-65(71)76-7)45-33-37-50-48-20-14-16-28-60(48)74(3,4)63(50)41-45/h9-42H,1-8H3 |
| InChIKey | MMPKMTDJPHLKCO-UHFFFAOYSA-N |
| XLogP | 19.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 991.29 |
| LogP ≤ 5 | 19.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|