C31H24F6N2O5 — CID 20822512
4-(4-acetylphenoxy)-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide (PubChem CID 20822512) has the molecular formula C31H24F6N2O5 and a molecular weight of 618.53 g/mol. Its IUPAC name is 4-(4-acetylphenoxy)-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide.
| Compound Name | 4-(4-acetylphenoxy)-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide |
|---|---|
| PubChem CID | 20822512 |
| Molecular Formula | C31H24F6N2O5 |
| Molecular Weight | 618.53 g/mol |
| Exact Mass | 618.16 |
| IUPAC Name | 4-(4-acetylphenoxy)-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide |
| SMILES | CNc1cc(C(c2ccc(O)c(NC(=O)c3ccc(Oc4ccc(C(C)=O)cc4)cc3)c2)(C(F)(F)F)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C31H24F6N2O5/c1-17(40)18-3-9-22(10-4-18)44-23-11-5-19(6-12-23)28(43)39-25-16-21(8-14-27(25)42)29(30(32,33)34,31(35,36)37)20-7-13-26(41)24(15-20)38-2/h3-16,38,41-42H,1-2H3,(H,39,43) |
| InChIKey | YWNYHHJACKDLSG-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.53 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|