C18H16F6N2O3 — CID 20822521
N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]acetamide (PubChem CID 20822521) has the molecular formula C18H16F6N2O3 and a molecular weight of 422.33 g/mol. Its IUPAC name is N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]acetamide.
| Compound Name | N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 20822521 |
| Molecular Formula | C18H16F6N2O3 |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-(methylamino)phenyl]propan-2-yl]-2-hydroxyphenyl]acetamide |
| SMILES | CNc1cc(C(c2ccc(O)c(NC(C)=O)c2)(C(F)(F)F)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C18H16F6N2O3/c1-9(27)26-13-8-11(4-6-15(13)29)16(17(19,20)21,18(22,23)24)10-3-5-14(28)12(7-10)25-2/h3-8,25,28-29H,1-2H3,(H,26,27) |
| InChIKey | PKJOUCXJOYBSCB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|