About (4-ethylphenyl) sulfate
(4-ethylphenyl) sulfate (PubChem CID 20822573) has the molecular formula C8H9O4S-
and a molecular weight of 201.22 g/mol. Its IUPAC name is (4-ethylphenyl) sulfate.
Molecular Properties
| Compound Name | (4-ethylphenyl) sulfate |
| PubChem CID | 20822573 |
| Molecular Formula | C8H9O4S- |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | (4-ethylphenyl) sulfate |
| SMILES | CCc1ccc(OS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C8H10O4S/c1-2-7-3-5-8(6-4-7)12-13(9,10)11/h3-6H,2H2,1H3,(H,9,10,11)/p-1 |
| InChIKey | DWZGLEPNCRFCEP-UHFFFAOYSA-M |
| XLogP | 1.09 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze (4-ethylphenyl) sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylphenyl) sulfate?
The IUPAC name of (4-ethylphenyl) sulfate (CID 20822573) is (4-ethylphenyl) sulfate.
What is the SMILES notation for (4-ethylphenyl) sulfate?
The canonical SMILES for (4-ethylphenyl) sulfate is CCc1ccc(OS(=O)(=O)[O-])cc1.
What is the InChIKey of (4-ethylphenyl) sulfate?
The InChIKey is DWZGLEPNCRFCEP-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10O4S/c1-2-7-3-5-8(6-4-7)12-13(9,10)11/h3-6H,2H2,1H3,(H,9,10,11)/p-1.
What are the key properties of (4-ethylphenyl) sulfate?
(4-ethylphenyl) sulfate has a molecular weight of 201.22 g/mol, XLogP of 1.09, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylphenyl) sulfate is sourced from PubChem (CID 20822573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).