C17H30 — CID 20822617
5-hepta-1,6-dien-2-yl-1,1,3,3-tetramethylcyclohexane (PubChem CID 20822617) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is 5-hepta-1,6-dien-2-yl-1,1,3,3-tetramethylcyclohexane.
| Compound Name | 5-hepta-1,6-dien-2-yl-1,1,3,3-tetramethylcyclohexane |
|---|---|
| PubChem CID | 20822617 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | 5-hepta-1,6-dien-2-yl-1,1,3,3-tetramethylcyclohexane |
| SMILES | C=CCCCC(=C)C1CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C17H30/c1-7-8-9-10-14(2)15-11-16(3,4)13-17(5,6)12-15/h7,15H,1-2,8-13H2,3-6H3 |
| InChIKey | HBZMHYVFNWPJLL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|