About 1-methyl-2-(3,4,4-trifluorobut-3-enylsulfonyl)imidazole
1-methyl-2-(3,4,4-trifluorobut-3-enylsulfonyl)imidazole (PubChem CID 20822746) has the molecular formula C8H9F3N2O2S
and a molecular weight of 254.23 g/mol. Its IUPAC name is 1-methyl-2-(3,4,4-trifluorobut-3-enylsulfonyl)imidazole.
Molecular Properties
| Compound Name | 1-methyl-2-(3,4,4-trifluorobut-3-enylsulfonyl)imidazole |
| PubChem CID | 20822746 |
| Molecular Formula | C8H9F3N2O2S |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1-methyl-2-(3,4,4-trifluorobut-3-enylsulfonyl)imidazole |
| SMILES | Cn1ccnc1S(=O)(=O)CCC(F)=C(F)F |
| InChI | InChI=1S/C8H9F3N2O2S/c1-13-4-3-12-8(13)16(14,15)5-2-6(9)7(10)11/h3-4H,2,5H2,1H3 |
| InChIKey | SOQUSILOSXMWBK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-2-(3,4,4-trifluorobut-3-enylsulfonyl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-(3,4,4-trifluorobut-3-enylsulfonyl)imidazole?
The IUPAC name of 1-methyl-2-(3,4,4-trifluorobut-3-enylsulfonyl)imidazole (CID 20822746) is 1-methyl-2-(3,4,4-trifluorobut-3-enylsulfonyl)imidazole.
What is the SMILES notation for 1-methyl-2-(3,4,4-trifluorobut-3-enylsulfonyl)imidazole?
The canonical SMILES for 1-methyl-2-(3,4,4-trifluorobut-3-enylsulfonyl)imidazole is Cn1ccnc1S(=O)(=O)CCC(F)=C(F)F.
What is the InChIKey of 1-methyl-2-(3,4,4-trifluorobut-3-enylsulfonyl)imidazole?
The InChIKey is SOQUSILOSXMWBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O2S/c1-13-4-3-12-8(13)16(14,15)5-2-6(9)7(10)11/h3-4H,2,5H2,1H3.
What are the key properties of 1-methyl-2-(3,4,4-trifluorobut-3-enylsulfonyl)imidazole?
1-methyl-2-(3,4,4-trifluorobut-3-enylsulfonyl)imidazole has a molecular weight of 254.23 g/mol, XLogP of 1.66, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-(3,4,4-trifluorobut-3-enylsulfonyl)imidazole is sourced from PubChem (CID 20822746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).