About 1,3-dihydronaphtho[2,3-f][2]benzofuran
1,3-dihydronaphtho[2,3-f][2]benzofuran (PubChem CID 20823213) has the molecular formula C16H12O
and a molecular weight of 220.27 g/mol. Its IUPAC name is 1,3-dihydronaphtho[2,3-f][2]benzofuran.
Molecular Properties
| Compound Name | 1,3-dihydronaphtho[2,3-f][2]benzofuran |
| PubChem CID | 20823213 |
| Molecular Formula | C16H12O |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 1,3-dihydronaphtho[2,3-f][2]benzofuran |
| SMILES | c1ccc2cc3cc4c(cc3cc2c1)COC4 |
| InChI | InChI=1S/C16H12O/c1-2-4-12-6-14-8-16-10-17-9-15(16)7-13(14)5-11(12)3-1/h1-8H,9-10H2 |
| InChIKey | VZPDQSVBXDMZDD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dihydronaphtho[2,3-f][2]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydronaphtho[2,3-f][2]benzofuran?
The IUPAC name of 1,3-dihydronaphtho[2,3-f][2]benzofuran (CID 20823213) is 1,3-dihydronaphtho[2,3-f][2]benzofuran.
What is the SMILES notation for 1,3-dihydronaphtho[2,3-f][2]benzofuran?
The canonical SMILES for 1,3-dihydronaphtho[2,3-f][2]benzofuran is c1ccc2cc3cc4c(cc3cc2c1)COC4.
What is the InChIKey of 1,3-dihydronaphtho[2,3-f][2]benzofuran?
The InChIKey is VZPDQSVBXDMZDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O/c1-2-4-12-6-14-8-16-10-17-9-15(16)7-13(14)5-11(12)3-1/h1-8H,9-10H2.
What are the key properties of 1,3-dihydronaphtho[2,3-f][2]benzofuran?
1,3-dihydronaphtho[2,3-f][2]benzofuran has a molecular weight of 220.27 g/mol, XLogP of 4.02, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydronaphtho[2,3-f][2]benzofuran is sourced from PubChem (CID 20823213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).