C8H6F10O — CID 20823501
2,3-bis(1,1-difluoroethyl)-2,3,4,4,5,5-hexafluorooxolane (PubChem CID 20823501) has the molecular formula C8H6F10O and a molecular weight of 308.12 g/mol. Its IUPAC name is 2,3-bis(1,1-difluoroethyl)-2,3,4,4,5,5-hexafluorooxolane.
| Compound Name | 2,3-bis(1,1-difluoroethyl)-2,3,4,4,5,5-hexafluorooxolane |
|---|---|
| PubChem CID | 20823501 |
| Molecular Formula | C8H6F10O |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 2,3-bis(1,1-difluoroethyl)-2,3,4,4,5,5-hexafluorooxolane |
| SMILES | CC(F)(F)C1(F)OC(F)(F)C(F)(F)C1(F)C(C)(F)F |
| InChI | InChI=1S/C8H6F10O/c1-3(9,10)5(13)6(14,15)8(17,18)19-7(5,16)4(2,11)12/h1-2H3 |
| InChIKey | GHYXBHUOIWVLFA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|