C31H37F15O5 — CID 20823624
ditert-butyl 6-(1,1-difluoroethyl)-6-fluoro-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-methyl-2,8-bis(trifluoromethyl)nonanedioate (PubChem CID 20823624) has the molecular formula C31H37F15O5 and a molecular weight of 774.60 g/mol. Its IUPAC name is ditert-butyl 6-(1,1-difluoroethyl)-6-fluoro-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-methyl-2,8-bis(trifluoromethyl)nonanedioate.
| Compound Name | ditert-butyl 6-(1,1-difluoroethyl)-6-fluoro-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-methyl-2,8-bis(trifluoromethyl)nonanedioate |
|---|---|
| PubChem CID | 20823624 |
| Molecular Formula | C31H37F15O5 |
| Molecular Weight | 774.60 g/mol |
| Exact Mass | 774.24 |
| IUPAC Name | ditert-butyl 6-(1,1-difluoroethyl)-6-fluoro-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-methyl-2,8-bis(trifluoromethyl)nonanedioate |
| SMILES | CC(C)(C)OC(=O)C(CC(F)(CC(CC(C)(C(=O)OC(C)(C)C)C(F)(F)F)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)C(C)(F)F)C(F)(F)F |
| InChI | InChI=1S/C31H37F15O5/c1-22(2,3)50-20(47)19(28(35,36)37)15-26(34,25(8,32)33)14-17(13-24(7,29(38,39)40)21(48)51-23(4,5)6)16-9-11-18(12-10-16)27(49,30(41,42)43)31(44,45)46/h9-12,17,19,49H,13-15H2,1-8H3 |
| InChIKey | XALALMJWZUZYEE-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.60 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |