C22H27F9O3 — CID 20823625
tert-butyl 4-(1,1-difluoroethyl)-4-fluoro-6-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]heptanoate (PubChem CID 20823625) has the molecular formula C22H27F9O3 and a molecular weight of 510.44 g/mol. Its IUPAC name is tert-butyl 4-(1,1-difluoroethyl)-4-fluoro-6-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]heptanoate.
| Compound Name | tert-butyl 4-(1,1-difluoroethyl)-4-fluoro-6-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]heptanoate |
|---|---|
| PubChem CID | 20823625 |
| Molecular Formula | C22H27F9O3 |
| Molecular Weight | 510.44 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | tert-butyl 4-(1,1-difluoroethyl)-4-fluoro-6-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]heptanoate |
| SMILES | CC(CC(F)(CCC(=O)OC(C)(C)C)C(C)(F)F)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H27F9O3/c1-13(12-19(25,18(5,23)24)11-10-16(32)34-17(2,3)4)14-6-8-15(9-7-14)20(33,21(26,27)28)22(29,30)31/h6-9,13,33H,10-12H2,1-5H3 |
| InChIKey | FLLONVSDJGPPJA-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.44 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |