C10H16BO2 — CID 20823713
(3AS,4S,6S,7aR)-3a,5,5-trimethylhexahydro-4,6-methanobenzo[d][1,3,2]dioxaborole (PubChem CID 20823713) has the molecular formula C10H16BO2 and a molecular weight of 179.05 g/mol.
| Compound Name | (3AS,4S,6S,7aR)-3a,5,5-trimethylhexahydro-4,6-methanobenzo[d][1,3,2]dioxaborole |
|---|---|
| PubChem CID | 20823713 |
| Molecular Formula | C10H16BO2 |
| Molecular Weight | 179.05 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | — |
| SMILES | CC1(C)[C@@H]2C[C@H]3O[B]O[C@@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C10H16BO2/c1-9(2)6-4-7(9)10(3)8(5-6)12-11-13-10/h6-8H,4-5H2,1-3H3/t6-,7-,8+,10-/m0/s1 |
| InChIKey | LWAMOOKWTDKVFQ-OORONAJNSA-N |
| XLogP | 1.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.05 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|