C9H8IN3 — CID 20823864
4-[(3-iodophenyl)methyl]-1,2,4-triazole (PubChem CID 20823864) has the molecular formula C9H8IN3 and a molecular weight of 285.09 g/mol. Its IUPAC name is 4-[(3-iodophenyl)methyl]-1,2,4-triazole.
| Compound Name | 4-[(3-iodophenyl)methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 20823864 |
| Molecular Formula | C9H8IN3 |
| Molecular Weight | 285.09 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 4-[(3-iodophenyl)methyl]-1,2,4-triazole |
| SMILES | Ic1cccc(Cn2cnnc2)c1 |
| InChI | InChI=1S/C9H8IN3/c10-9-3-1-2-8(4-9)5-13-6-11-12-7-13/h1-4,6-7H,5H2 |
| InChIKey | CZHZQNWNTJNCBN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.09 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|