C17H14N4O2S — CID 20823956
3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]benzoic acid (PubChem CID 20823956) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is 3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]benzoic acid.
| Compound Name | 3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]benzoic acid |
|---|---|
| PubChem CID | 20823956 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]benzoic acid |
| SMILES | CNc1nc2cc(-c3cccc(C(=O)O)c3)sc2n2c(C)cnc12 |
| InChI | InChI=1S/C17H14N4O2S/c1-9-8-19-15-14(18-2)20-12-7-13(24-16(12)21(9)15)10-4-3-5-11(6-10)17(22)23/h3-8H,1-2H3,(H,18,20)(H,22,23) |
| InChIKey | BZXWGXXSVTXQQR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |