C17H15FN4OS — CID 20823957
2-[[4-(4-fluorophenyl)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl]amino]ethanol (PubChem CID 20823957) has the molecular formula C17H15FN4OS and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[[4-(4-fluorophenyl)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl]amino]ethanol.
| Compound Name | 2-[[4-(4-fluorophenyl)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl]amino]ethanol |
|---|---|
| PubChem CID | 20823957 |
| Molecular Formula | C17H15FN4OS |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-[[4-(4-fluorophenyl)-12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl]amino]ethanol |
| SMILES | Cc1cnc2c(NCCO)nc3cc(-c4ccc(F)cc4)sc3n12 |
| InChI | InChI=1S/C17H15FN4OS/c1-10-9-20-16-15(19-6-7-23)21-13-8-14(24-17(13)22(10)16)11-2-4-12(18)5-3-11/h2-5,8-9,23H,6-7H2,1H3,(H,19,21) |
| InChIKey | KXYQQRTYMVPJTR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |