C16H14N4S — CID 20823960
N,12-dimethyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine (PubChem CID 20823960) has the molecular formula C16H14N4S and a molecular weight of 294.38 g/mol. Its IUPAC name is N,12-dimethyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine.
| Compound Name | N,12-dimethyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine |
|---|---|
| PubChem CID | 20823960 |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | N,12-dimethyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine |
| SMILES | CNc1nc2cc(-c3ccccc3)sc2n2c(C)cnc12 |
| InChI | InChI=1S/C16H14N4S/c1-10-9-18-15-14(17-2)19-12-8-13(21-16(12)20(10)15)11-6-4-3-5-7-11/h3-9H,1-2H3,(H,17,19) |
| InChIKey | YYPSPWXMCGXAQH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |