C22H25N5S — CID 20823975
12-methyl-4-phenyl-N-(2-piperidin-1-ylethyl)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine (PubChem CID 20823975) has the molecular formula C22H25N5S and a molecular weight of 391.54 g/mol. Its IUPAC name is 12-methyl-4-phenyl-N-(2-piperidin-1-ylethyl)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine.
| Compound Name | 12-methyl-4-phenyl-N-(2-piperidin-1-ylethyl)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine |
|---|---|
| PubChem CID | 20823975 |
| Molecular Formula | C22H25N5S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 12-methyl-4-phenyl-N-(2-piperidin-1-ylethyl)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine |
| SMILES | Cc1cnc2c(NCCN3CCCCC3)nc3cc(-c4ccccc4)sc3n12 |
| InChI | InChI=1S/C22H25N5S/c1-16-15-24-21-20(23-10-13-26-11-6-3-7-12-26)25-18-14-19(28-22(18)27(16)21)17-8-4-2-5-9-17/h2,4-5,8-9,14-15H,3,6-7,10-13H2,1H3,(H,23,25) |
| InChIKey | KRIKINNADKZJQU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |