C19H21N5S — CID 20823982
N',N'-dimethyl-N-(12-methyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)ethane-1,2-diamine (PubChem CID 20823982) has the molecular formula C19H21N5S and a molecular weight of 351.48 g/mol. Its IUPAC name is N',N'-dimethyl-N-(12-methyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-(12-methyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 20823982 |
| Molecular Formula | C19H21N5S |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | N',N'-dimethyl-N-(12-methyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)ethane-1,2-diamine |
| SMILES | Cc1cnc2c(NCCN(C)C)nc3cc(-c4ccccc4)sc3n12 |
| InChI | InChI=1S/C19H21N5S/c1-13-12-21-18-17(20-9-10-23(2)3)22-15-11-16(25-19(15)24(13)18)14-7-5-4-6-8-14/h4-8,11-12H,9-10H2,1-3H3,(H,20,22) |
| InChIKey | YEGWKIFISRCWRD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |