C16H13N3OS — CID 20823998
8-methoxy-12-methyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 20823998) has the molecular formula C16H13N3OS and a molecular weight of 295.37 g/mol. Its IUPAC name is 8-methoxy-12-methyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 8-methoxy-12-methyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 20823998 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 8-methoxy-12-methyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | COc1nc2cc(-c3ccccc3)sc2n2c(C)cnc12 |
| InChI | InChI=1S/C16H13N3OS/c1-10-9-17-14-15(20-2)18-12-8-13(21-16(12)19(10)14)11-6-4-3-5-7-11/h3-9H,1-2H3 |
| InChIKey | ROCPTTVMVKUQNN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |