C20H23N5OS — CID 20824023
4-(furan-2-yl)-12-methyl-N-(2-piperidin-1-ylethyl)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine (PubChem CID 20824023) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is 4-(furan-2-yl)-12-methyl-N-(2-piperidin-1-ylethyl)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine.
| Compound Name | 4-(furan-2-yl)-12-methyl-N-(2-piperidin-1-ylethyl)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine |
|---|---|
| PubChem CID | 20824023 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 4-(furan-2-yl)-12-methyl-N-(2-piperidin-1-ylethyl)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine |
| SMILES | Cc1cnc2c(NCCN3CCCCC3)nc3cc(-c4ccco4)sc3n12 |
| InChI | InChI=1S/C20H23N5OS/c1-14-13-22-19-18(21-7-10-24-8-3-2-4-9-24)23-15-12-17(16-6-5-11-26-16)27-20(15)25(14)19/h5-6,11-13H,2-4,7-10H2,1H3,(H,21,23) |
| InChIKey | BEKDHZDURVFMHI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 58.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |