C10H10N4S — CID 20824041
N,12-dimethyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine (PubChem CID 20824041) has the molecular formula C10H10N4S and a molecular weight of 218.28 g/mol. Its IUPAC name is N,12-dimethyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine.
| Compound Name | N,12-dimethyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine |
|---|---|
| PubChem CID | 20824041 |
| Molecular Formula | C10H10N4S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | N,12-dimethyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine |
| SMILES | CNc1nc2ccsc2n2c(C)cnc12 |
| InChI | InChI=1S/C10H10N4S/c1-6-5-12-9-8(11-2)13-7-3-4-15-10(7)14(6)9/h3-5H,1-2H3,(H,11,13) |
| InChIKey | XOFJGRBXJNCBQW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |