C9H7N3OS — CID 20824046
12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraen-8-one (PubChem CID 20824046) has the molecular formula C9H7N3OS and a molecular weight of 205.24 g/mol. Its IUPAC name is 12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraen-8-one.
| Compound Name | 12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraen-8-one |
|---|---|
| PubChem CID | 20824046 |
| Molecular Formula | C9H7N3OS |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 12-methyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraen-8-one |
| SMILES | Cc1cnc2c(=O)[nH]c3ccsc3n12 |
| InChI | InChI=1S/C9H7N3OS/c1-5-4-10-7-8(13)11-6-2-3-14-9(6)12(5)7/h2-4H,1H3,(H,11,13) |
| InChIKey | KMGRJTISMUARHR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |