C19H29N5O2SSn — CID 20824055
tert-butyl N-[2-[(12-methyl-4-trimethylstannyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)amino]ethyl]carbamate (PubChem CID 20824055) has the molecular formula C19H29N5O2SSn and a molecular weight of 510.25 g/mol. Its IUPAC name is tert-butyl N-[2-[(12-methyl-4-trimethylstannyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(12-methyl-4-trimethylstannyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 20824055 |
| Molecular Formula | C19H29N5O2SSn |
| Molecular Weight | 510.25 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | tert-butyl N-[2-[(12-methyl-4-trimethylstannyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)amino]ethyl]carbamate |
| SMILES | Cc1cnc2c(NCCNC(=O)OC(C)(C)C)nc3cc([Sn](C)(C)C)sc3n12 |
| InChI | InChI=1S/C16H20N5O2S.3CH3.Sn/c1-10-9-19-13-12(20-11-5-8-24-14(11)21(10)13)17-6-7-18-15(22)23-16(2,3)4;;;;/h5,9H,6-7H2,1-4H3,(H,17,20)(H,18,22);3*1H3; |
| InChIKey | BGBJGXRGCUWUDA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|