C17H16N4S — CID 20824060
N-ethyl-12-methyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine (PubChem CID 20824060) has the molecular formula C17H16N4S and a molecular weight of 308.41 g/mol. Its IUPAC name is N-ethyl-12-methyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine.
| Compound Name | N-ethyl-12-methyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine |
|---|---|
| PubChem CID | 20824060 |
| Molecular Formula | C17H16N4S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | N-ethyl-12-methyl-4-phenyl-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-amine |
| SMILES | CCNc1nc2cc(-c3ccccc3)sc2n2c(C)cnc12 |
| InChI | InChI=1S/C17H16N4S/c1-3-18-15-16-19-10-11(2)21(16)17-13(20-15)9-14(22-17)12-7-5-4-6-8-12/h4-10H,3H2,1-2H3,(H,18,20) |
| InChIKey | DOFSHRCUJLPYEE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |